C8H12N4O5S2 — CID 112674449
N-(2-amino-2-oxoethoxy)-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide (PubChem CID 112674449) has the molecular formula C8H12N4O5S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 112674449 |
| Molecular Formula | C8H12N4O5S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide |
| SMILES | CS(=O)(=O)Nc1nc(CC(=O)NOCC(N)=O)cs1 |
| InChI | InChI=1S/C8H12N4O5S2/c1-19(15,16)12-8-10-5(4-18-8)2-7(14)11-17-3-6(9)13/h4H,2-3H2,1H3,(H2,9,13)(H,10,12)(H,11,14) |
| InChIKey | XYHCJRDRRXSZCL-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|