C14H19ClN4O3S2 — CID 87242893
N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]methanesulfonamide;hydrochloride (PubChem CID 87242893) has the molecular formula C14H19ClN4O3S2 and a molecular weight of 390.92 g/mol. Its IUPAC name is N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 87242893 |
| Molecular Formula | C14H19ClN4O3S2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1nc(CCc2ccc(CC(=O)NN)cc2)cs1.Cl |
| InChI | InChI=1S/C14H18N4O3S2.ClH/c1-23(20,21)18-14-16-12(9-22-14)7-6-10-2-4-11(5-3-10)8-13(19)17-15;/h2-5,9H,6-8,15H2,1H3,(H,16,18)(H,17,19);1H |
| InChIKey | RMEPIAQTDJMIAW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|