C15H20N4O3S2 — CID 44538377
N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]ethanesulfonamide (PubChem CID 44538377) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]ethanesulfonamide.
| Compound Name | N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 44538377 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-1,3-thiazol-2-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1nc(CCc2ccc(CC(=O)NN)cc2)cs1 |
| InChI | InChI=1S/C15H20N4O3S2/c1-2-24(21,22)19-15-17-13(10-23-15)8-7-11-3-5-12(6-4-11)9-14(20)18-16/h3-6,10H,2,7-9,16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | GFXVMXBQROEMAK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|