C19H27Cl2N5O2S — CID 67030732
2-[4-[2-[2-(4-acetylpiperazin-1-yl)-1,3-thiazol-4-yl]ethyl]phenyl]acetohydrazide;dihydrochloride (PubChem CID 67030732) has the molecular formula C19H27Cl2N5O2S and a molecular weight of 460.43 g/mol. Its IUPAC name is 2-[4-[2-[2-(4-acetylpiperazin-1-yl)-1,3-thiazol-4-yl]ethyl]phenyl]acetohydrazide;dihydrochloride.
| Compound Name | 2-[4-[2-[2-(4-acetylpiperazin-1-yl)-1,3-thiazol-4-yl]ethyl]phenyl]acetohydrazide;dihydrochloride |
|---|---|
| PubChem CID | 67030732 |
| Molecular Formula | C19H27Cl2N5O2S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-[4-[2-[2-(4-acetylpiperazin-1-yl)-1,3-thiazol-4-yl]ethyl]phenyl]acetohydrazide;dihydrochloride |
| SMILES | CC(=O)N1CCN(c2nc(CCc3ccc(CC(=O)NN)cc3)cs2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H25N5O2S.2ClH/c1-14(25)23-8-10-24(11-9-23)19-21-17(13-27-19)7-6-15-2-4-16(5-3-15)12-18(26)22-20;;/h2-5,13H,6-12,20H2,1H3,(H,22,26);2*1H |
| InChIKey | WSZMQSROHINDBY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|