C20H28Cl2N4O2S — CID 67029947
2-[4-[2-[5-(4-acetylpiperazin-1-yl)thiophen-2-yl]ethyl]phenyl]acetohydrazide;dihydrochloride (PubChem CID 67029947) has the molecular formula C20H28Cl2N4O2S and a molecular weight of 459.44 g/mol. Its IUPAC name is 2-[4-[2-[5-(4-acetylpiperazin-1-yl)thiophen-2-yl]ethyl]phenyl]acetohydrazide;dihydrochloride.
| Compound Name | 2-[4-[2-[5-(4-acetylpiperazin-1-yl)thiophen-2-yl]ethyl]phenyl]acetohydrazide;dihydrochloride |
|---|---|
| PubChem CID | 67029947 |
| Molecular Formula | C20H28Cl2N4O2S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[4-[2-[5-(4-acetylpiperazin-1-yl)thiophen-2-yl]ethyl]phenyl]acetohydrazide;dihydrochloride |
| SMILES | CC(=O)N1CCN(c2ccc(CCc3ccc(CC(=O)NN)cc3)s2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H26N4O2S.2ClH/c1-15(25)23-10-12-24(13-11-23)20-9-8-18(27-20)7-6-16-2-4-17(5-3-16)14-19(26)22-21;;/h2-5,8-9H,6-7,10-14,21H2,1H3,(H,22,26);2*1H |
| InChIKey | CKVUBVHCLMAHHS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|