C10H17N3O3S2 — CID 60716435
N-butan-2-yl-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide (PubChem CID 60716435) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-butan-2-yl-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 60716435 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-butan-2-yl-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCC(C)NC(=O)Cc1csc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H17N3O3S2/c1-4-7(2)11-9(14)5-8-6-17-10(12-8)13-18(3,15)16/h6-7H,4-5H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | WZGFXSHHHFNXSG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |