C22H25N3O3S2 — CID 51931287
N-[(1R)-1,4-diphenylbutyl]-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide (PubChem CID 51931287) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[(1R)-1,4-diphenylbutyl]-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(1R)-1,4-diphenylbutyl]-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 51931287 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[(1R)-1,4-diphenylbutyl]-2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetamide |
| SMILES | CS(=O)(=O)Nc1nc(CC(=O)N[C@H](CCCc2ccccc2)c2ccccc2)cs1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-30(27,28)25-22-23-19(16-29-22)15-21(26)24-20(18-12-6-3-7-13-18)14-8-11-17-9-4-2-5-10-17/h2-7,9-10,12-13,16,20H,8,11,14-15H2,1H3,(H,23,25)(H,24,26)/t20-/m1/s1 |
| InChIKey | MEVAWVVFRCHHIX-HXUWFJFHSA-N |
| XLogP | 3.94 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |