C9H11F2NOS — CID 112676076
3-[(3,5-difluoro-2-pyridinyl)sulfanyl]butan-1-ol (PubChem CID 112676076) has the molecular formula C9H11F2NOS and a molecular weight of 219.26 g/mol. Its IUPAC name is 3-[(3,5-difluoro-2-pyridinyl)sulfanyl]butan-1-ol.
| Compound Name | 3-[(3,5-difluoro-2-pyridinyl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 112676076 |
| Molecular Formula | C9H11F2NOS |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 3-[(3,5-difluoro-2-pyridinyl)sulfanyl]butan-1-ol |
| SMILES | CC(CCO)Sc1ncc(F)cc1F |
| InChI | InChI=1S/C9H11F2NOS/c1-6(2-3-13)14-9-8(11)4-7(10)5-12-9/h4-6,13H,2-3H2,1H3 |
| InChIKey | JRCCFIJKUJRFDQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |