C8H9F2N3 — CID 112676196
N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine (PubChem CID 112676196) has the molecular formula C8H9F2N3 and a molecular weight of 185.18 g/mol. Its IUPAC name is N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine.
| Compound Name | N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112676196 |
| Molecular Formula | C8H9F2N3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine |
| SMILES | Fc1cnc(NC2CNC2)c(F)c1 |
| InChI | InChI=1S/C8H9F2N3/c9-5-1-7(10)8(12-2-5)13-6-3-11-4-6/h1-2,6,11H,3-4H2,(H,12,13) |
| InChIKey | VZJYVLHNTPZFMM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |