About N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine
N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine (PubChem CID 112676196) has the molecular formula C8H9F2N3
and a molecular weight of 185.18 g/mol. Its IUPAC name is N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine |
| PubChem CID | 112676196 |
| Molecular Formula | C8H9F2N3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine |
| SMILES | Fc1cnc(NC2CNC2)c(F)c1 |
| InChI | InChI=1S/C8H9F2N3/c9-5-1-7(10)8(12-2-5)13-6-3-11-4-6/h1-2,6,11H,3-4H2,(H,12,13) |
| InChIKey | VZJYVLHNTPZFMM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine?
The IUPAC name of N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine (CID 112676196) is N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine.
What is the SMILES notation for N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine?
The canonical SMILES for N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine is Fc1cnc(NC2CNC2)c(F)c1.
What is the InChIKey of N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine?
The InChIKey is VZJYVLHNTPZFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N3/c9-5-1-7(10)8(12-2-5)13-6-3-11-4-6/h1-2,6,11H,3-4H2,(H,12,13).
What are the key properties of N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine?
N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine has a molecular weight of 185.18 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-3,5-difluoropyridin-2-amine is sourced from PubChem (CID 112676196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).