C11H16ClNO4S2 — CID 112676744
5-[ethyl(2-methoxyethyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride (PubChem CID 112676744) has the molecular formula C11H16ClNO4S2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 5-[ethyl(2-methoxyethyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride.
| Compound Name | 5-[ethyl(2-methoxyethyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 112676744 |
| Molecular Formula | C11H16ClNO4S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-[ethyl(2-methoxyethyl)carbamoyl]-2-methylthiophene-3-sulfonyl chloride |
| SMILES | CCN(CCOC)C(=O)c1cc(S(=O)(=O)Cl)c(C)s1 |
| InChI | InChI=1S/C11H16ClNO4S2/c1-4-13(5-6-17-3)11(14)9-7-10(8(2)18-9)19(12,15)16/h7H,4-6H2,1-3H3 |
| InChIKey | ZBGSOKQTQHTGSR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |