C11H14FN3 — CID 112680364
5-ethyl-5-(2-fluorophenyl)-1,4-dihydroimidazol-2-amine (PubChem CID 112680364) has the molecular formula C11H14FN3 and a molecular weight of 207.25 g/mol. Its IUPAC name is 5-ethyl-5-(2-fluorophenyl)-1,4-dihydroimidazol-2-amine.
| Compound Name | 5-ethyl-5-(2-fluorophenyl)-1,4-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 112680364 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 5-ethyl-5-(2-fluorophenyl)-1,4-dihydroimidazol-2-amine |
| SMILES | CCC1(c2ccccc2F)CN=C(N)N1 |
| InChI | InChI=1S/C11H14FN3/c1-2-11(7-14-10(13)15-11)8-5-3-4-6-9(8)12/h3-6H,2,7H2,1H3,(H3,13,14,15) |
| InChIKey | LTWKTEHCEJOKKG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |