C10H12FN3 — CID 79509455
5-(3-fluorophenyl)-5-methyl-1,4-dihydroimidazol-2-amine (PubChem CID 79509455) has the molecular formula C10H12FN3 and a molecular weight of 193.23 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-5-methyl-1,4-dihydroimidazol-2-amine.
| Compound Name | 5-(3-fluorophenyl)-5-methyl-1,4-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79509455 |
| Molecular Formula | C10H12FN3 |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 5-(3-fluorophenyl)-5-methyl-1,4-dihydroimidazol-2-amine |
| SMILES | CC1(c2cccc(F)c2)CN=C(N)N1 |
| InChI | InChI=1S/C10H12FN3/c1-10(6-13-9(12)14-10)7-3-2-4-8(11)5-7/h2-5H,6H2,1H3,(H3,12,13,14) |
| InChIKey | PCTFPCYEIKVNAI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |