C17H15FN4 — CID 141426056
2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrimidine (PubChem CID 141426056) has the molecular formula C17H15FN4 and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrimidine.
| Compound Name | 2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrimidine |
|---|---|
| PubChem CID | 141426056 |
| Molecular Formula | C17H15FN4 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)-5-[2-(3-fluorophenyl)ethynyl]pyrimidine |
| SMILES | CC1(C)CN=C(c2ncc(C#Cc3cccc(F)c3)cn2)N1 |
| InChI | InChI=1S/C17H15FN4/c1-17(2)11-21-16(22-17)15-19-9-13(10-20-15)7-6-12-4-3-5-14(18)8-12/h3-5,8-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | XYMLGXANYARMEI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|