C10H17F3N2O — CID 112685104
1-cyclohexyl-3-(3,3,3-trifluoropropyl)urea (PubChem CID 112685104) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-cyclohexyl-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 112685104 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-cyclohexyl-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C10H17F3N2O/c11-10(12,13)6-7-14-9(16)15-8-4-2-1-3-5-8/h8H,1-7H2,(H2,14,15,16) |
| InChIKey | RTMCOIWIKGZDSQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |