C11H12N4O3S — CID 112690383
5-nitro-N-(5-propyl-1H-pyrazol-3-yl)thiophene-2-carboxamide (PubChem CID 112690383) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 5-nitro-N-(5-propyl-1H-pyrazol-3-yl)thiophene-2-carboxamide.
| Compound Name | 5-nitro-N-(5-propyl-1H-pyrazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112690383 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-nitro-N-(5-propyl-1H-pyrazol-3-yl)thiophene-2-carboxamide |
| SMILES | CCCc1cc(NC(=O)c2ccc([N+](=O)[O-])s2)n[nH]1 |
| InChI | InChI=1S/C11H12N4O3S/c1-2-3-7-6-9(14-13-7)12-11(16)8-4-5-10(19-8)15(17)18/h4-6H,2-3H2,1H3,(H2,12,13,14,16) |
| InChIKey | ORWSIIJKSOGLGU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|