C11H13N5O3 — CID 115621174
4-nitro-N-(5-propyl-1H-pyrazol-3-yl)-1H-pyrrole-2-carboxamide (PubChem CID 115621174) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-nitro-N-(5-propyl-1H-pyrazol-3-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-nitro-N-(5-propyl-1H-pyrazol-3-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115621174 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-nitro-N-(5-propyl-1H-pyrazol-3-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CCCc1cc(NC(=O)c2cc([N+](=O)[O-])c[nH]2)n[nH]1 |
| InChI | InChI=1S/C11H13N5O3/c1-2-3-7-4-10(15-14-7)13-11(17)9-5-8(6-12-9)16(18)19/h4-6,12H,2-3H2,1H3,(H2,13,14,15,17) |
| InChIKey | CHJWYLOPYMIVHU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|