C15H30OSiTe — CID 11269049
tert-butyl-[(2E,4Z)-5-butyltellanylpenta-2,4-dienoxy]-dimethylsilane (PubChem CID 11269049) has the molecular formula C15H30OSiTe and a molecular weight of 382.09 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z)-5-butyltellanylpenta-2,4-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z)-5-butyltellanylpenta-2,4-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11269049 |
| Molecular Formula | C15H30OSiTe |
| Molecular Weight | 382.09 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | tert-butyl-[(2E,4Z)-5-butyltellanylpenta-2,4-dienoxy]-dimethylsilane |
| SMILES | CCCC[Te]/C=C\C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSiTe/c1-7-8-13-18-14-11-9-10-12-16-17(5,6)15(2,3)4/h9-11,14H,7-8,12-13H2,1-6H3/b10-9+,14-11- |
| InChIKey | QFQYCFPVOBHZAE-POLRJCGMSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.09 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|