C12H26O2Si2 — CID 552473
trimethyl(6-trimethylsilyloxyhexa-2,4-dienoxy)silane (PubChem CID 552473) has the molecular formula C12H26O2Si2 and a molecular weight of 258.51 g/mol. Its IUPAC name is trimethyl(6-trimethylsilyloxyhexa-2,4-dienoxy)silane.
| Compound Name | trimethyl(6-trimethylsilyloxyhexa-2,4-dienoxy)silane |
|---|---|
| PubChem CID | 552473 |
| Molecular Formula | C12H26O2Si2 |
| Molecular Weight | 258.51 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | trimethyl(6-trimethylsilyloxyhexa-2,4-dienoxy)silane |
| SMILES | C[Si](C)(C)OCC=CC=CCO[Si](C)(C)C |
| InChI | InChI=1S/C12H26O2Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h7-10H,11-12H2,1-6H3 |
| InChIKey | BRDWJIGUXQZSET-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|