C11H24O2Si2 — CID 10977700
trimethyl-[(2Z)-4-trimethylsilyloxypenta-2,4-dien-2-yl]oxysilane (PubChem CID 10977700) has the molecular formula C11H24O2Si2 and a molecular weight of 244.48 g/mol. Its IUPAC name is trimethyl-[(2Z)-4-trimethylsilyloxypenta-2,4-dien-2-yl]oxysilane.
| Compound Name | trimethyl-[(2Z)-4-trimethylsilyloxypenta-2,4-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 10977700 |
| Molecular Formula | C11H24O2Si2 |
| Molecular Weight | 244.48 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | trimethyl-[(2Z)-4-trimethylsilyloxypenta-2,4-dien-2-yl]oxysilane |
| SMILES | C=C(/C=C(/C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H24O2Si2/c1-10(12-14(3,4)5)9-11(2)13-15(6,7)8/h9H,1H2,2-8H3/b11-9- |
| InChIKey | HVOHENMYTHWXRH-LUAWRHEFSA-N |
| XLogP | 4.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|