C7H10N2O2 — CID 112695144
3-(oxolan-3-yl)-1,4-dihydropyrazol-5-one (PubChem CID 112695144) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-1,4-dihydropyrazol-5-one.
| Compound Name | 3-(oxolan-3-yl)-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 112695144 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-(oxolan-3-yl)-1,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(C2CCOC2)=NN1 |
| InChI | InChI=1S/C7H10N2O2/c10-7-3-6(8-9-7)5-1-2-11-4-5/h5H,1-4H2,(H,9,10) |
| InChIKey | JJBBZAVDABNSBS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |