C12H16FNOS — CID 112698063
2-fluoro-N,5-dimethyl-N-(2-methylsulfanylethyl)benzamide (PubChem CID 112698063) has the molecular formula C12H16FNOS and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-fluoro-N,5-dimethyl-N-(2-methylsulfanylethyl)benzamide.
| Compound Name | 2-fluoro-N,5-dimethyl-N-(2-methylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 112698063 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-fluoro-N,5-dimethyl-N-(2-methylsulfanylethyl)benzamide |
| SMILES | CSCCN(C)C(=O)c1cc(C)ccc1F |
| InChI | InChI=1S/C12H16FNOS/c1-9-4-5-11(13)10(8-9)12(15)14(2)6-7-16-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | WZRRNJYRZKNGHY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |