C16H32N2O — CID 112700337
N-tert-butyl-2-[(3,3,5-trimethylcyclohexyl)amino]propanamide (PubChem CID 112700337) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is N-tert-butyl-2-[(3,3,5-trimethylcyclohexyl)amino]propanamide.
| Compound Name | N-tert-butyl-2-[(3,3,5-trimethylcyclohexyl)amino]propanamide |
|---|---|
| PubChem CID | 112700337 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N-tert-butyl-2-[(3,3,5-trimethylcyclohexyl)amino]propanamide |
| SMILES | CC1CC(NC(C)C(=O)NC(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H32N2O/c1-11-8-13(10-16(6,7)9-11)17-12(2)14(19)18-15(3,4)5/h11-13,17H,8-10H2,1-7H3,(H,18,19) |
| InChIKey | NXGUIQNXUIUOAW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |