About 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol
2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol (PubChem CID 112709588) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol.
Molecular Properties
| Compound Name | 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol |
| PubChem CID | 112709588 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol |
| SMILES | CC(N)C(O)c1ccn2nccc2c1 |
| InChI | InChI=1S/C10H13N3O/c1-7(11)10(14)8-3-5-13-9(6-8)2-4-12-13/h2-7,10,14H,11H2,1H3 |
| InChIKey | ODYNDAQORKNFIL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol?
The IUPAC name of 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol (CID 112709588) is 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol.
What is the SMILES notation for 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol?
The canonical SMILES for 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol is CC(N)C(O)c1ccn2nccc2c1.
What is the InChIKey of 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol?
The InChIKey is ODYNDAQORKNFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-7(11)10(14)8-3-5-13-9(6-8)2-4-12-13/h2-7,10,14H,11H2,1H3.
What are the key properties of 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol?
2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol has a molecular weight of 191.23 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-pyrazolo[1,5-a]pyridin-5-ylpropan-1-ol is sourced from PubChem (CID 112709588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).