C10H12N2S — CID 139409644
1-pyrazolo[1,5-a]pyridin-5-ylpropane-2-thiol (PubChem CID 139409644) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyridin-5-ylpropane-2-thiol.
| Compound Name | 1-pyrazolo[1,5-a]pyridin-5-ylpropane-2-thiol |
|---|---|
| PubChem CID | 139409644 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyridin-5-ylpropane-2-thiol |
| SMILES | CC(S)Cc1ccn2nccc2c1 |
| InChI | InChI=1S/C10H12N2S/c1-8(13)6-9-3-5-12-10(7-9)2-4-11-12/h2-5,7-8,13H,6H2,1H3 |
| InChIKey | MWYVNSKOOJNJHW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|