C9H10N2OS — CID 112712848
1-(3a,7a-dihydro-1,2-benzothiazol-5-yl)-2-aminoethanone (PubChem CID 112712848) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 1-(3a,7a-dihydro-1,2-benzothiazol-5-yl)-2-aminoethanone.
| Compound Name | 1-(3a,7a-dihydro-1,2-benzothiazol-5-yl)-2-aminoethanone |
|---|---|
| PubChem CID | 112712848 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-(3a,7a-dihydro-1,2-benzothiazol-5-yl)-2-aminoethanone |
| SMILES | NCC(=O)C1=CC2C=NSC2C=C1 |
| InChI | InChI=1S/C9H10N2OS/c10-4-8(12)6-1-2-9-7(3-6)5-11-13-9/h1-3,5,7,9H,4,10H2 |
| InChIKey | FGMAVQVPBSFTER-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|