About 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one
1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one (PubChem CID 112713796) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one |
| PubChem CID | 112713796 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one |
| SMILES | CC(=O)Cc1coc(N2CCOCC2)n1 |
| InChI | InChI=1S/C10H14N2O3/c1-8(13)6-9-7-15-10(11-9)12-2-4-14-5-3-12/h7H,2-6H2,1H3 |
| InChIKey | LRRZBJCAAPBHMW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one?
The IUPAC name of 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one (CID 112713796) is 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one.
What is the SMILES notation for 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one?
The canonical SMILES for 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one is CC(=O)Cc1coc(N2CCOCC2)n1.
What is the InChIKey of 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one?
The InChIKey is LRRZBJCAAPBHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-8(13)6-9-7-15-10(11-9)12-2-4-14-5-3-12/h7H,2-6H2,1H3.
What are the key properties of 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one?
1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one has a molecular weight of 210.23 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-morpholin-4-yl-1,3-oxazol-4-yl)propan-2-one is sourced from PubChem (CID 112713796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).