C13H14ClN5O — CID 112729784
[4-(2-chlorophenyl)piperazin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 112729784) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 112729784 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C13H14ClN5O/c14-10-3-1-2-4-12(10)18-5-7-19(8-6-18)13(20)11-9-15-17-16-11/h1-4,9H,5-8H2,(H,15,16,17) |
| InChIKey | PBJAFIOUMKAQID-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |