C34H32ClF3N2O — CID 11273187
N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1-methylindol-4-yl)oxypropan-1-amine (PubChem CID 11273187) has the molecular formula C34H32ClF3N2O and a molecular weight of 577.09 g/mol. Its IUPAC name is N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1-methylindol-4-yl)oxypropan-1-amine.
| Compound Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1-methylindol-4-yl)oxypropan-1-amine |
|---|---|
| PubChem CID | 11273187 |
| Molecular Formula | C34H32ClF3N2O |
| Molecular Weight | 577.09 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1-methylindol-4-yl)oxypropan-1-amine |
| SMILES | Cn1ccc2c(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)cccc21 |
| InChI | InChI=1S/C34H32ClF3N2O/c1-39-21-19-28-31(39)17-9-18-32(28)41-22-10-20-40(23-27-15-8-16-30(33(27)35)34(36,37)38)24-29(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-9,11-19,21,29H,10,20,22-24H2,1H3 |
| InChIKey | YBVHXCRCXDFGNF-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.09 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|