C33H30ClF3N2O — CID 25190757
N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1H-indol-4-yloxy)propan-1-amine (PubChem CID 25190757) has the molecular formula C33H30ClF3N2O and a molecular weight of 563.06 g/mol. Its IUPAC name is N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1H-indol-4-yloxy)propan-1-amine.
| Compound Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1H-indol-4-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 25190757 |
| Molecular Formula | C33H30ClF3N2O |
| Molecular Weight | 563.06 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-N-(2,2-diphenylethyl)-3-(1H-indol-4-yloxy)propan-1-amine |
| SMILES | FC(F)(F)c1cccc(CN(CCCOc2cccc3[nH]ccc23)CC(c2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C33H30ClF3N2O/c34-32-26(14-7-15-29(32)33(35,36)37)22-39(20-9-21-40-31-17-8-16-30-27(31)18-19-38-30)23-28(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-8,10-19,28,38H,9,20-23H2 |
| InChIKey | FSENUVJQKQCYBD-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.06 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|