C36H34ClF3N2O3 — CID 25190755
methyl 2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-1H-indol-3-yl]acetate (PubChem CID 25190755) has the molecular formula C36H34ClF3N2O3 and a molecular weight of 635.13 g/mol. Its IUPAC name is methyl 2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-1H-indol-3-yl]acetate.
| Compound Name | methyl 2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 25190755 |
| Molecular Formula | C36H34ClF3N2O3 |
| Molecular Weight | 635.13 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | methyl 2-[5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-1H-indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c[nH]c2ccc(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C36H34ClF3N2O3/c1-44-34(43)20-28-22-41-33-17-16-29(21-30(28)33)45-19-9-18-42(23-27-14-8-15-32(35(27)37)36(38,39)40)24-31(25-10-4-2-5-11-25)26-12-6-3-7-13-26/h2-8,10-17,21-22,31,41H,9,18-20,23-24H2,1H3 |
| InChIKey | QCPMSPLCIPCOOQ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.13 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|