C13H20N4S — CID 112735841
1-(2-methyltriazol-4-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 112735841) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 1-(2-methyltriazol-4-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-(2-methyltriazol-4-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 112735841 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(2-methyltriazol-4-yl)-N-propyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCCNC(CCc1cccs1)c1cnn(C)n1 |
| InChI | InChI=1S/C13H20N4S/c1-3-8-14-12(13-10-15-17(2)16-13)7-6-11-5-4-9-18-11/h4-5,9-10,12,14H,3,6-8H2,1-2H3 |
| InChIKey | HMUPQAKXIGDSMA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |