C10H12FNO4S — CID 112737060
(4S)-2-[(4-fluorophenyl)methylsulfonyl]-1,2-oxazolidin-4-ol (PubChem CID 112737060) has the molecular formula C10H12FNO4S and a molecular weight of 261.27 g/mol. Its IUPAC name is (4S)-2-[(4-fluorophenyl)methylsulfonyl]-1,2-oxazolidin-4-ol.
| Compound Name | (4S)-2-[(4-fluorophenyl)methylsulfonyl]-1,2-oxazolidin-4-ol |
|---|---|
| PubChem CID | 112737060 |
| Molecular Formula | C10H12FNO4S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (4S)-2-[(4-fluorophenyl)methylsulfonyl]-1,2-oxazolidin-4-ol |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N1C[C@H](O)CO1 |
| InChI | InChI=1S/C10H12FNO4S/c11-9-3-1-8(2-4-9)7-17(14,15)12-5-10(13)6-16-12/h1-4,10,13H,5-7H2/t10-/m0/s1 |
| InChIKey | JRPKJBVDNMKPAQ-JTQLQIEISA-N |
| XLogP | 0.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |