C11H19F3N2OS — CID 112737656
3-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]butanethioamide (PubChem CID 112737656) has the molecular formula C11H19F3N2OS and a molecular weight of 284.35 g/mol. Its IUPAC name is 3-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]butanethioamide.
| Compound Name | 3-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]butanethioamide |
|---|---|
| PubChem CID | 112737656 |
| Molecular Formula | C11H19F3N2OS |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[4-hydroxy-4-(trifluoromethyl)azepan-1-yl]butanethioamide |
| SMILES | CC(CC(N)=S)N1CCCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N2OS/c1-8(7-9(15)18)16-5-2-3-10(17,4-6-16)11(12,13)14/h8,17H,2-7H2,1H3,(H2,15,18) |
| InChIKey | QVMIMKHGHAXYOT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|