C14H16Br2N2 — CID 112742724
N-[(2,4-dibromophenyl)-(1H-pyrrol-2-yl)methyl]propan-1-amine (PubChem CID 112742724) has the molecular formula C14H16Br2N2 and a molecular weight of 372.10 g/mol. Its IUPAC name is N-[(2,4-dibromophenyl)-(1H-pyrrol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(2,4-dibromophenyl)-(1H-pyrrol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 112742724 |
| Molecular Formula | C14H16Br2N2 |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | N-[(2,4-dibromophenyl)-(1H-pyrrol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc[nH]1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H16Br2N2/c1-2-7-18-14(13-4-3-8-17-13)11-6-5-10(15)9-12(11)16/h3-6,8-9,14,17-18H,2,7H2,1H3 |
| InChIKey | RJEUDTSLGVAKHI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |