C13H23F2NO3 — CID 112743084
ethyl 3-[butan-2-yl(butyl)amino]-2,2-difluoro-3-oxopropanoate (PubChem CID 112743084) has the molecular formula C13H23F2NO3 and a molecular weight of 279.33 g/mol. Its IUPAC name is ethyl 3-[butan-2-yl(butyl)amino]-2,2-difluoro-3-oxopropanoate.
| Compound Name | ethyl 3-[butan-2-yl(butyl)amino]-2,2-difluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 112743084 |
| Molecular Formula | C13H23F2NO3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethyl 3-[butan-2-yl(butyl)amino]-2,2-difluoro-3-oxopropanoate |
| SMILES | CCCCN(C(=O)C(F)(F)C(=O)OCC)C(C)CC |
| InChI | InChI=1S/C13H23F2NO3/c1-5-8-9-16(10(4)6-2)11(17)13(14,15)12(18)19-7-3/h10H,5-9H2,1-4H3 |
| InChIKey | BNPMVIYEINGYFL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|