C15H32N2O — CID 65269662
3-amino-N-butan-2-yl-N-butyl-2,2,3-trimethylbutanamide (PubChem CID 65269662) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 3-amino-N-butan-2-yl-N-butyl-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-butan-2-yl-N-butyl-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65269662 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 3-amino-N-butan-2-yl-N-butyl-2,2,3-trimethylbutanamide |
| SMILES | CCCCN(C(=O)C(C)(C)C(C)(C)N)C(C)CC |
| InChI | InChI=1S/C15H32N2O/c1-8-10-11-17(12(3)9-2)13(18)14(4,5)15(6,7)16/h12H,8-11,16H2,1-7H3 |
| InChIKey | ZYQBGQALAYXSFQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |