C13H24N2OS — CID 80589820
N-butan-2-yl-N-butyl-1-carbamothioylcyclopropane-1-carboxamide (PubChem CID 80589820) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-1-carbamothioylcyclopropane-1-carboxamide.
| Compound Name | N-butan-2-yl-N-butyl-1-carbamothioylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80589820 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-butan-2-yl-N-butyl-1-carbamothioylcyclopropane-1-carboxamide |
| SMILES | CCCCN(C(=O)C1(C(N)=S)CC1)C(C)CC |
| InChI | InChI=1S/C13H24N2OS/c1-4-6-9-15(10(3)5-2)12(16)13(7-8-13)11(14)17/h10H,4-9H2,1-3H3,(H2,14,17) |
| InChIKey | MTMYNXOHZZECST-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|