C12H22F3NO2 — CID 78883098
N-butan-2-yl-N-butyl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 78883098) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-butan-2-yl-N-butyl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 78883098 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-butan-2-yl-N-butyl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCCCN(C(=O)COCC(F)(F)F)C(C)CC |
| InChI | InChI=1S/C12H22F3NO2/c1-4-6-7-16(10(3)5-2)11(17)8-18-9-12(13,14)15/h10H,4-9H2,1-3H3 |
| InChIKey | IBCYDSHIJRPQCR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |