C10H16F2N2O4 — CID 112743156
ethyl 3-[(1-amino-2-methyl-1-oxobutan-2-yl)amino]-2,2-difluoro-3-oxopropanoate (PubChem CID 112743156) has the molecular formula C10H16F2N2O4 and a molecular weight of 266.24 g/mol. Its IUPAC name is ethyl 3-[(1-amino-2-methyl-1-oxobutan-2-yl)amino]-2,2-difluoro-3-oxopropanoate.
| Compound Name | ethyl 3-[(1-amino-2-methyl-1-oxobutan-2-yl)amino]-2,2-difluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 112743156 |
| Molecular Formula | C10H16F2N2O4 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethyl 3-[(1-amino-2-methyl-1-oxobutan-2-yl)amino]-2,2-difluoro-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)NC(C)(CC)C(N)=O |
| InChI | InChI=1S/C10H16F2N2O4/c1-4-9(3,6(13)15)14-7(16)10(11,12)8(17)18-5-2/h4-5H2,1-3H3,(H2,13,15)(H,14,16) |
| InChIKey | CUMNZYXQYRILPD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|