C15H13N3O — CID 112744195
1-(2-methyl-1,2,4-triazol-3-yl)-2-naphthalen-1-ylethanone (PubChem CID 112744195) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-(2-methyl-1,2,4-triazol-3-yl)-2-naphthalen-1-ylethanone.
| Compound Name | 1-(2-methyl-1,2,4-triazol-3-yl)-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 112744195 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(2-methyl-1,2,4-triazol-3-yl)-2-naphthalen-1-ylethanone |
| SMILES | Cn1ncnc1C(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C15H13N3O/c1-18-15(16-10-17-18)14(19)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-8,10H,9H2,1H3 |
| InChIKey | XZDCTHDIUDIECV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |