C11H23N3O3S — CID 112747021
2-[2-cyclobutylethylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide (PubChem CID 112747021) has the molecular formula C11H23N3O3S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[2-cyclobutylethylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[2-cyclobutylethylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 112747021 |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[2-cyclobutylethylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide |
| SMILES | CCCN(CC(N)=NO)S(=O)(=O)CCC1CCC1 |
| InChI | InChI=1S/C11H23N3O3S/c1-2-7-14(9-11(12)13-15)18(16,17)8-6-10-4-3-5-10/h10,15H,2-9H2,1H3,(H2,12,13) |
| InChIKey | LVEQNDAEVVXACU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|