C10H23N3O3S — CID 77045063
2-[2,2-dimethylpropylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide (PubChem CID 77045063) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-[2,2-dimethylpropylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[2,2-dimethylpropylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77045063 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[2,2-dimethylpropylsulfonyl(propyl)amino]-N'-hydroxyethanimidamide |
| SMILES | CCCN(CC(N)=NO)S(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H23N3O3S/c1-5-6-13(7-9(11)12-14)17(15,16)8-10(2,3)4/h14H,5-8H2,1-4H3,(H2,11,12) |
| InChIKey | SAWSEWBLAJOURY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|