C13H16BrClN2O — CID 112750068
N-(2-bromo-5-chloro-3-pyridinyl)-2,2-dimethylcyclopentane-1-carboxamide (PubChem CID 112750068) has the molecular formula C13H16BrClN2O and a molecular weight of 331.64 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-3-pyridinyl)-2,2-dimethylcyclopentane-1-carboxamide.
| Compound Name | N-(2-bromo-5-chloro-3-pyridinyl)-2,2-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 112750068 |
| Molecular Formula | C13H16BrClN2O |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-(2-bromo-5-chloro-3-pyridinyl)-2,2-dimethylcyclopentane-1-carboxamide |
| SMILES | CC1(C)CCCC1C(=O)Nc1cc(Cl)cnc1Br |
| InChI | InChI=1S/C13H16BrClN2O/c1-13(2)5-3-4-9(13)12(18)17-10-6-8(15)7-16-11(10)14/h6-7,9H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | LCDXQPQIQUCXCC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|