C9H14FN3O3S — CID 112751598
2-(2-aminoethoxy)-N-(5-fluoro-2-pyridinyl)ethanesulfonamide (PubChem CID 112751598) has the molecular formula C9H14FN3O3S and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(5-fluoro-2-pyridinyl)ethanesulfonamide.
| Compound Name | 2-(2-aminoethoxy)-N-(5-fluoro-2-pyridinyl)ethanesulfonamide |
|---|---|
| PubChem CID | 112751598 |
| Molecular Formula | C9H14FN3O3S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(5-fluoro-2-pyridinyl)ethanesulfonamide |
| SMILES | NCCOCCS(=O)(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C9H14FN3O3S/c10-8-1-2-9(12-7-8)13-17(14,15)6-5-16-4-3-11/h1-2,7H,3-6,11H2,(H,12,13) |
| InChIKey | QZTDLKNEANCZRW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|