C12H16F2N2O2 — CID 112751875
3-[(2-amino-4,5-difluoroanilino)methyl]-2-methyloxolan-3-ol (PubChem CID 112751875) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-[(2-amino-4,5-difluoroanilino)methyl]-2-methyloxolan-3-ol.
| Compound Name | 3-[(2-amino-4,5-difluoroanilino)methyl]-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 112751875 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-[(2-amino-4,5-difluoroanilino)methyl]-2-methyloxolan-3-ol |
| SMILES | CC1OCCC1(O)CNc1cc(F)c(F)cc1N |
| InChI | InChI=1S/C12H16F2N2O2/c1-7-12(17,2-3-18-7)6-16-11-5-9(14)8(13)4-10(11)15/h4-5,7,16-17H,2-3,6,15H2,1H3 |
| InChIKey | BNYWHJVEPYRJEZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|