C12H14N2OS2 — CID 112753795
2-[2-[(6-methoxy-3-pyridinyl)methyl]-1,3-thiazol-4-yl]ethanethiol (PubChem CID 112753795) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[2-[(6-methoxy-3-pyridinyl)methyl]-1,3-thiazol-4-yl]ethanethiol.
| Compound Name | 2-[2-[(6-methoxy-3-pyridinyl)methyl]-1,3-thiazol-4-yl]ethanethiol |
|---|---|
| PubChem CID | 112753795 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[2-[(6-methoxy-3-pyridinyl)methyl]-1,3-thiazol-4-yl]ethanethiol |
| SMILES | COc1ccc(Cc2nc(CCS)cs2)cn1 |
| InChI | InChI=1S/C12H14N2OS2/c1-15-11-3-2-9(7-13-11)6-12-14-10(4-5-16)8-17-12/h2-3,7-8,16H,4-6H2,1H3 |
| InChIKey | DUAURUGFCLIXFK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|