C9H8IN3OS — CID 102618449
5-iodo-3-[(6-methoxy-3-pyridinyl)methyl]-1,2,4-thiadiazole (PubChem CID 102618449) has the molecular formula C9H8IN3OS and a molecular weight of 333.15 g/mol. Its IUPAC name is 5-iodo-3-[(6-methoxy-3-pyridinyl)methyl]-1,2,4-thiadiazole.
| Compound Name | 5-iodo-3-[(6-methoxy-3-pyridinyl)methyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618449 |
| Molecular Formula | C9H8IN3OS |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 5-iodo-3-[(6-methoxy-3-pyridinyl)methyl]-1,2,4-thiadiazole |
| SMILES | COc1ccc(Cc2nsc(I)n2)cn1 |
| InChI | InChI=1S/C9H8IN3OS/c1-14-8-3-2-6(5-11-8)4-7-12-9(10)15-13-7/h2-3,5H,4H2,1H3 |
| InChIKey | QEPILSUTWDQZQY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|