C10H7BrIN3O2S — CID 112755380
4-bromo-N-[(5-iodo-1,3-thiazol-2-yl)methyl]-3-nitroaniline (PubChem CID 112755380) has the molecular formula C10H7BrIN3O2S and a molecular weight of 440.06 g/mol. Its IUPAC name is 4-bromo-N-[(5-iodo-1,3-thiazol-2-yl)methyl]-3-nitroaniline.
| Compound Name | 4-bromo-N-[(5-iodo-1,3-thiazol-2-yl)methyl]-3-nitroaniline |
|---|---|
| PubChem CID | 112755380 |
| Molecular Formula | C10H7BrIN3O2S |
| Molecular Weight | 440.06 g/mol |
| Exact Mass | 438.85 |
| IUPAC Name | 4-bromo-N-[(5-iodo-1,3-thiazol-2-yl)methyl]-3-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(NCc2ncc(I)s2)ccc1Br |
| InChI | InChI=1S/C10H7BrIN3O2S/c11-7-2-1-6(3-8(7)15(16)17)13-5-10-14-4-9(12)18-10/h1-4,13H,5H2 |
| InChIKey | FGKIGIOFZPKSMU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.06 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|