About (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride
(3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride (PubChem CID 112756488) has the molecular formula C4H9Cl2NO2S
and a molecular weight of 206.09 g/mol. Its IUPAC name is (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride |
| PubChem CID | 112756488 |
| Molecular Formula | C4H9Cl2NO2S |
| Molecular Weight | 206.09 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C4H8ClNO2S.ClH/c5-3-1-9(7,8)2-4(3)6;/h3-4H,1-2,6H2;1H/t3-,4-;/m1./s1 |
| InChIKey | MKBVEVDILHMLNA-VKKIDBQXSA-N |
| XLogP | -0.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.09 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride?
The IUPAC name of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride (CID 112756488) is (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride.
What is the SMILES notation for (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride?
The canonical SMILES for (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride is Cl.N[C@@H]1CS(=O)(=O)C[C@H]1Cl.
What is the InChIKey of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride?
The InChIKey is MKBVEVDILHMLNA-VKKIDBQXSA-N. The full InChI is InChI=1S/C4H8ClNO2S.ClH/c5-3-1-9(7,8)2-4(3)6;/h3-4H,1-2,6H2;1H/t3-,4-;/m1./s1.
What are the key properties of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride?
(3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride has a molecular weight of 206.09 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride is sourced from PubChem (CID 112756488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).