C4H9Cl2NO2S — CID 112756488
(3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride (PubChem CID 112756488) has the molecular formula C4H9Cl2NO2S and a molecular weight of 206.09 g/mol. Its IUPAC name is (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride.
| Compound Name | (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 112756488 |
| Molecular Formula | C4H9Cl2NO2S |
| Molecular Weight | 206.09 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C4H8ClNO2S.ClH/c5-3-1-9(7,8)2-4(3)6;/h3-4H,1-2,6H2;1H/t3-,4-;/m1./s1 |
| InChIKey | MKBVEVDILHMLNA-VKKIDBQXSA-N |
| XLogP | -0.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.09 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|