C12H17NO3 — CID 11276120
(2R,3S)-1-[benzyl(hydroxy)amino]pent-4-ene-2,3-diol (PubChem CID 11276120) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (2R,3S)-1-[benzyl(hydroxy)amino]pent-4-ene-2,3-diol.
| Compound Name | (2R,3S)-1-[benzyl(hydroxy)amino]pent-4-ene-2,3-diol |
|---|---|
| PubChem CID | 11276120 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2R,3S)-1-[benzyl(hydroxy)amino]pent-4-ene-2,3-diol |
| SMILES | C=C[C@H](O)[C@H](O)CN(O)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-2-11(14)12(15)9-13(16)8-10-6-4-3-5-7-10/h2-7,11-12,14-16H,1,8-9H2/t11-,12+/m0/s1 |
| InChIKey | VPMMGEBJNDLRID-NWDGAFQWSA-N |
| XLogP | 0.79 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|